![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| thumbnails/ | 2020-11-10 21:36 | - | |
| Flow_ST.png | 2012-05-08 14:55 | 11K | |
| form.docx | 2012-05-08 14:55 | 20K | |
| model01.png | 2012-05-08 14:55 | 25K | |
| 002.PNG | 2012-05-08 14:55 | 30K | |
| research_flow.png | 2012-05-08 14:55 | 46K | |
| Locative Media As Socialising And Spatializing Practice_Learning From Archaeology.pdf | 2012-05-08 14:55 | 49K | |
| smartphone.jpg | 2012-05-08 14:55 | 51K | |
| img_.png | 2012-05-08 14:55 | 51K | |
| Modeling the structure of the flow experience among Web users.pdf | 2012-05-08 14:55 | 59K | |
| researchflow.png | 2012-05-08 14:55 | 67K | |
| 001.PNG | 2012-05-08 14:55 | 68K | |
| New Media Arts Hybridity.pdf | 2012-05-08 14:55 | 82K | |
| plan.pptx | 2012-05-08 14:55 | 84K | |
| img.png | 2012-05-08 14:55 | 94K | |
| NRF.enl | 2012-05-08 14:55 | 104K | |
| NRF.jpg | 2012-05-08 14:55 | 104K | |
| Presence.pdf | 2012-05-08 14:55 | 107K | |
| Hybrid Reality Games Reframed.pdf | 2012-05-08 14:55 | 117K | |
| img.jpg | 2012-05-08 14:55 | 129K | |
| MiniCabrio01.png | 2012-05-08 14:55 | 142K | |
| MiniCabrio02.png | 2012-05-08 14:55 | 152K | |
| 02.jpg | 2012-05-08 14:55 | 160K | |
| MiniCabrio03.png | 2012-05-08 14:55 | 162K | |
| Convergence_img.jpg | 2012-05-08 14:55 | 168K | |
| flow1.png | 2012-05-08 14:55 | 183K | |
| Nissan_Cube02.png | 2012-05-08 14:55 | 191K | |
| Arch01.png | 2012-05-08 14:55 | 205K | |
| 융합연구_img.jpg | 2012-05-08 14:55 | 211K | |
| Nissan_Cube01.png | 2012-05-08 14:55 | 224K | |
| plan.pdf | 2012-05-08 14:55 | 232K | |
| 01.jpg | 2012-05-08 14:55 | 232K | |
| 03.jpg | 2012-05-08 14:55 | 401K | |
| dbpia0757074.pdf | 2012-05-08 14:55 | 489K | |
| plan_edited.pdf | 2012-05-08 14:55 | 543K | |
| An exploration from virtual to augmented reality gaming.pdf | 2012-05-08 14:55 | 547K | |
| Advances in Games Technology.pdf | 2012-05-08 14:55 | 815K | |
| dbpia0819528.pdf | 2012-05-08 14:55 | 873K | |
| dbpia0937969.pdf | 2012-05-08 14:55 | 1.0M | |
| dbpia0900173.pdf | 2012-05-08 14:55 | 1.0M | |
| dbpia1221622.pdf | 2012-05-08 14:55 | 1.7M | |
| dbpia1085260.pdf | 2012-05-08 14:55 | 1.8M | |
| proposal.docx | 2012-05-08 14:55 | 2.3M | |
| dbpia1218430.pdf | 2012-05-08 14:55 | 2.4M | |
| _1.pdf | 2012-05-08 14:55 | 2.4M | |
| plan_edited2.pdf | 2012-05-08 14:55 | 2.4M | |
| plan_edited_.pdf | 2012-05-08 14:55 | 2.4M | |
| Notes.docx | 2012-05-08 14:55 | 3.5M | |
| dbpia1192136.pdf | 2012-05-08 14:55 | 6.1M | |
| LOCATIVE MEDIA AND INFORMATIONAL TERRITORIES.pdf | 2012-05-08 14:55 | 6.4M | |
| NRF.zip | 2012-05-08 14:55 | 77M | |